Difference between revisions of "PWY-5800"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1)...")
(Created page with "Category:pathway == Pathway P641-PWY == * taxonomic-range: ** tax-2 * common-name: ** phenylmercury acetate degradation == Reaction(s) found == * MERCURY-II-REDUCTASE-RX...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+
== Pathway P641-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** trans-cinnamate
+
** phenylmercury acetate degradation
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c=cc1(=cc=cc=c1)
+
* [[MERCURY-II-REDUCTASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wbywaxjhaxsjni-votsokgwsa-m
+
* [NoneR581-RXN R581-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 147.153
+
{{#set: common-name=phenylmercury acetate degradation}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-2001]]
+
{{#set: completion rate=0.5}}
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
+
{{#set: nb total reaction=2}}
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=trans-cinnamate}}
 
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
 
{{#set: molecular-weight=147.153}}
 

Revision as of 20:16, 18 December 2020

Pathway P641-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • phenylmercury acetate degradation

Reaction(s) found

Reaction(s) not found

  • [NoneR581-RXN R581-RXN]