Difference between revisions of "PWY-5805"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] == * common-name: ** scopolin * smiles: ** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DELTA1-PYRROLINE_5-CARBOXYLATE L-DELTA1-PYRROLINE_5-CARBOXYLATE] == * common-name: ** (s)-1-p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DELTA1-PYRROLINE_5-CARBOXYLATE L-DELTA1-PYRROLINE_5-CARBOXYLATE] ==
 
* common-name:
 
* common-name:
** scopolin
+
** (s)-1-pyrroline-5-carboxylate
 
* smiles:
 
* smiles:
** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o)))
+
** c1(=nc(cc1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** sgtcgccqzoumjj-ymiltqatsa-n
+
** dwaknkkxgalpnw-bypyzucnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 354.313
+
** 112.108
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14179]]
+
* [[PYRROLINECARBDEHYDROG-RXN]]
 +
* [[PYRROLINECARBREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14903]]
 +
* [[RXN0-7008]]
 +
* [[RXN66-542]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scopolin}}
+
{{#set: common-name=(s)-1-pyrroline-5-carboxylate}}
{{#set: inchi-key=inchikey=sgtcgccqzoumjj-ymiltqatsa-n}}
+
{{#set: inchi-key=inchikey=dwaknkkxgalpnw-bypyzucnsa-m}}
{{#set: molecular-weight=354.313}}
+
{{#set: molecular-weight=112.108}}

Revision as of 09:22, 27 August 2019

Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE

  • common-name:
    • (s)-1-pyrroline-5-carboxylate
  • smiles:
    • c1(=nc(cc1)c(=o)[o-])
  • inchi-key:
    • dwaknkkxgalpnw-bypyzucnsa-m
  • molecular-weight:
    • 112.108

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality