Difference between revisions of "PWY-5808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(...")
(Created page with "Category:pathway == Pathway PWY-5808 == * taxonomic-range: ** tax-55962 * common-name: ** hyperforin and adhyperforin biosynthesis == Reaction(s) found == * RXN-7810 *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] ==
+
== Pathway PWY-5808 ==
 +
* taxonomic-range:
 +
** tax-55962
 
* common-name:
 
* common-name:
** β-d-mannopyranose
+
** hyperforin and adhyperforin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o)o1)
+
* [[RXN-7810]]
* inchi-key:
+
* [[RXN-7811]]
** wqzgkkkjijffok-rwopyejcsa-n
+
* [[RXN-7813]]
* molecular-weight:
+
== Reaction(s) not found ==
** 180.157
+
* [NoneRXN-7805 RXN-7805]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-9135 RXN-9135]
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+
* [NoneRXN-7812 RXN-7812]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-13549 RXN-13549]
== Reaction(s) of unknown directionality ==
+
* [None2.3.1.156-RXN 2.3.1.156-RXN]
{{#set: common-name=β-d-mannopyranose}}
+
{{#set: taxonomic-range=tax-55962}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
+
{{#set: common-name=hyperforin and adhyperforin biosynthesis}}
{{#set: molecular-weight=180.157}}
+
{{#set: nb reaction found=3}}
 +
{{#set: completion rate=0.38}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5808

  • taxonomic-range:
    • tax-55962
  • common-name:
    • hyperforin and adhyperforin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7805 RXN-7805]
  • [NoneRXN-9135 RXN-9135]
  • [NoneRXN-7812 RXN-7812]
  • [NoneRXN-13549 RXN-13549]
  • [None2.3.1.156-RXN 2.3.1.156-RXN]