Difference between revisions of "PWY-5808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETR-Quinones ETR-Quinones] == * common-name: ** an electron-transfer quinone == Reaction(s) kno...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETR-Quinones ETR-Quinones] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] ==
 
* common-name:
 
* common-name:
** an electron-transfer quinone
+
** β-d-mannopyranose
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o)c(o)o1)
 +
* inchi-key:
 +
** wqzgkkkjijffok-rwopyejcsa-n
 +
* molecular-weight:
 +
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
* [[NQOR-RXN]]
 
* [[RXN-11356]]
 
* [[RXN-11357]]
 
* [[RXN-12242]]
 
* [[RXN-14903]]
 
* [[RXN-14971]]
 
* [[RXN-15745]]
 
* [[RXN0-7229]]
 
* [[RXN0-7230]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15816]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an electron-transfer quinone}}
+
{{#set: common-name=β-d-mannopyranose}}
 +
{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
 +
{{#set: molecular-weight=180.157}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12601

  • common-name:
    • β-d-mannopyranose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o)o1)
  • inchi-key:
    • wqzgkkkjijffok-rwopyejcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality