Difference between revisions of "PWY-5808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTANOL ISOBUTANOL] == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxe...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTANOL ISOBUTANOL] ==
 
* common-name:
 
* common-name:
** β-d-mannopyranose
+
** isobutanol
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o)o1)
+
** cc(c)co
 
* inchi-key:
 
* inchi-key:
** wqzgkkkjijffok-rwopyejcsa-n
+
** zxekiibdnhejcq-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 74.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+
* [[RXN-7657]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-mannopyranose}}
+
{{#set: common-name=isobutanol}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
+
{{#set: inchi-key=inchikey=zxekiibdnhejcq-uhfffaoysa-n}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=74.122}}

Revision as of 09:22, 27 August 2019

Metabolite ISOBUTANOL

  • common-name:
    • isobutanol
  • smiles:
    • cc(c)co
  • inchi-key:
    • zxekiibdnhejcq-uhfffaoysa-n
  • molecular-weight:
    • 74.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality