Difference between revisions of "PWY-5826"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] ==
 
* common-name:
 
* common-name:
** inosine
+
** 3-oxohexanoyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** ugqmrvrmyyaskq-kqynxxcusa-n
+
** nfoyyxqavvywkv-hdrqghtbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 268.229
+
** 875.63
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[HACD2h]]
 +
* [[RXN-12570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENODEAMIN-RXN]]
+
* [[ACACT2h]]
* [[I5NT]]
+
* [[HACD2h]]
* [[INOPHOSPHOR-RXN]]
+
* [[RXN-12565]]
* [[RXN-7607]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=inosine}}
+
{{#set: common-name=3-oxohexanoyl-coa}}
{{#set: inchi-key=inchikey=ugqmrvrmyyaskq-kqynxxcusa-n}}
+
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
{{#set: molecular-weight=268.229}}
+
{{#set: molecular-weight=875.63}}

Revision as of 14:19, 26 August 2019

Metabolite K-HEXANOYL-COA

  • common-name:
    • 3-oxohexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
  • inchi-key:
    • nfoyyxqavvywkv-hdrqghtbsa-j
  • molecular-weight:
    • 875.63

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality