Difference between revisions of "PWY-5826"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8347 CPD-8347] ==
+== Pathway PWY-5265 ==
+* taxonomic-range:
+** tax-201174
+** tax-1239
 * common-name:
-** 1-18:2-2-lysophosphatidylcholine
+** peptidoglycan biosynthesis ii (staphylococci)
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
+* [[RXN-8975]]
-* inchi-key:
+== Reaction(s) not found ==
-** spjfyyjxnpezdw-ftjopakqsa-n
+* [NoneRXN-20088 RXN-20088]
-* molecular-weight:
+* [NoneRXN-15521 RXN-15521]
-** 519.657
+* [NoneRXN-11291 RXN-11291]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11065 RXN-11065]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8976 RXN-8976]
-* [[RXN-12430]]
+{{#set: taxonomic-range=tax-201174|tax-1239}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=peptidoglycan biosynthesis ii (staphylococci)}}
-{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=519.657}}
+{{#set: nb total reaction=6}}