Difference between revisions of "PWY-5839"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] ==
+== Pathway PWY-5839 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** metanephrine
+** menaquinol-7 biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
+* [[RXN-9191]]
-* inchi-key:
+== Reaction(s) not found ==
-** jwjctzkfygdabj-vifpvbqesa-o
+* [NoneRXN-9190 RXN-9190]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2157}}
-** 198.241
+{{#set: common-name=menaquinol-7 biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-10913]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=metanephrine}}
-{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
-{{#set: molecular-weight=198.241}}