Difference between revisions of "PWY-5839"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-guanosine18 tRNA-guanosine18] == * common-name: ** a guanosine18 in trna == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-guanosine18 tRNA-guanosine18] ==
 
* common-name:
 
* common-name:
** metanephrine
+
** a guanosine18 in trna
* smiles:
 
** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
 
* inchi-key:
 
** jwjctzkfygdabj-vifpvbqesa-o
 
* molecular-weight:
 
** 198.241
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10913]]
+
* [[2.1.1.34-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=metanephrine}}
+
{{#set: common-name=a guanosine18 in trna}}
{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
 
{{#set: molecular-weight=198.241}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-guanosine18

  • common-name:
    • a guanosine18 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality