Difference between revisions of "PWY-5844"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * common-name: ** 2-epi-5-epi-valiolone * smiles: ** c(o)c1(o)(c(o)c(o)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-epi-5-epi-valiolone |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(o)(c(o)c(o)c(o)c(=o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jczfnxyqgnlhdq-mvioudgnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9140]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-epi-5-epi-valiolone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jczfnxyqgnlhdq-mvioudgnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.168}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-9663
- common-name:
- 2-epi-5-epi-valiolone
- smiles:
- c(o)c1(o)(c(o)c(o)c(o)c(=o)c1)
- inchi-key:
- jczfnxyqgnlhdq-mvioudgnsa-n
- molecular-weight:
- 192.168
