Difference between revisions of "PWY-5844"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * common-name: ** 2-epi-5-epi-valiolone * smiles: ** c(o)c1(o)(c(o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * common-name: ** 24-methylenecholesterol * smiles: ** cc(c)c(=c)ccc(c)[ch]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
 
* common-name:
 
* common-name:
** 2-epi-5-epi-valiolone
+
** 24-methylenecholesterol
 
* smiles:
 
* smiles:
** c(o)c1(o)(c(o)c(o)c(o)c(=o)c1)
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** jczfnxyqgnlhdq-mvioudgnsa-n
+
** indvlxyucbvvkw-pxbbazsnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 192.168
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9140]]
+
* [[RXN-707]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-epi-5-epi-valiolone}}
+
{{#set: common-name=24-methylenecholesterol}}
{{#set: inchi-key=inchikey=jczfnxyqgnlhdq-mvioudgnsa-n}}
+
{{#set: inchi-key=inchikey=indvlxyucbvvkw-pxbbazsnsa-n}}
{{#set: molecular-weight=192.168}}
+
{{#set: molecular-weight=398.671}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-706

  • common-name:
    • 24-methylenecholesterol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • indvlxyucbvvkw-pxbbazsnsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality