Difference between revisions of "PWY-5855"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)c...")
 
(Created page with "Category:pathway == Pathway PWY-5855 == * taxonomic-range: ** tax-2 * common-name: ** ubiquinol-7 biosynthesis (prokaryotic) == Reaction(s) found == * RXN-9225 * RXN...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] ==
+
== Pathway PWY-5855 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** n-acetyl-l-citrulline
+
** ubiquinol-7 biosynthesis (prokaryotic)
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc(c([o-])=o)cccnc(=o)n
+
* [[RXN-9225]]
* inchi-key:
+
* [[RXN-9227]]
** wmqmioyqxnrroc-lurjtmiesa-m
+
* [[RXN-9229]]
* molecular-weight:
+
== Reaction(s) not found ==
** 216.216
+
* [NoneRXN-9222 RXN-9222]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-9223 RXN-9223]
* [[RXN-7933]]
+
* [NoneRXN-9228 RXN-9228]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-9224 RXN-9224]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-9226 RXN-9226]
{{#set: common-name=n-acetyl-l-citrulline}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
+
{{#set: common-name=ubiquinol-7 biosynthesis (prokaryotic)}}
{{#set: molecular-weight=216.216}}
+
{{#set: nb reaction found=3}}
 +
{{#set: completion rate=0.38}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5855

  • taxonomic-range:
    • tax-2
  • common-name:
    • ubiquinol-7 biosynthesis (prokaryotic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9222 RXN-9222]
  • [NoneRXN-9223 RXN-9223]
  • [NoneRXN-9228 RXN-9228]
  • [NoneRXN-9224 RXN-9224]
  • [NoneRXN-9226 RXN-9226]