Difference between revisions of "PWY-5856"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] ==
+== Pathway PWY-5856 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** ubiquinol-7
+** ubiquinol-9 biosynthesis (prokaryotic)
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+* [[2.1.1.64-RXN]]
-* inchi-key:
+* [[RXN-9240]]
-** pfiusppkanbdhq-rjyqsxaysa-n
+* [[RXN-9242]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 661.019
+* [NoneRXN-9243 RXN-9243]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-9241 RXN-9241]
-== Reaction(s) known to produce the compound ==
+* [None2.5.1.39-RXN 2.5.1.39-RXN]
-* [[RXN-9229]]
+* [NoneRXN-9238 RXN-9238]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-9239 RXN-9239]
-{{#set: common-name=ubiquinol-7}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
+{{#set: common-name=ubiquinol-9 biosynthesis (prokaryotic)}}
-{{#set: molecular-weight=661.019}}
+{{#set: nb reaction found=3}}
+{{#set: completion rate=0.38}}
+{{#set: nb total reaction=8}}