Difference between revisions of "PWY-5856"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17271 CPD-17271] == * common-name: ** 1-stearoyl-2-palmitoyl-glycerol * smiles: ** cccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17271 CPD-17271] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] ==
 
* common-name:
 
* common-name:
** 1-stearoyl-2-palmitoyl-glycerol
+
** ubiquinol-7
 
* smiles:
 
* smiles:
** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
* inchi-key:
** vyqdalbeqrzdpl-dhujradrsa-n
+
** pfiusppkanbdhq-rjyqsxaysa-n
 
* molecular-weight:
 
* molecular-weight:
** 596.973
+
** 661.019
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
 
* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
 
* [[RXN-16030]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+
* [[RXN-9229]]
* [[RXN-16030]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-stearoyl-2-palmitoyl-glycerol}}
+
{{#set: common-name=ubiquinol-7}}
{{#set: inchi-key=inchikey=vyqdalbeqrzdpl-dhujradrsa-n}}
+
{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
{{#set: molecular-weight=596.973}}
+
{{#set: molecular-weight=661.019}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-9955

  • common-name:
    • ubiquinol-7
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • pfiusppkanbdhq-rjyqsxaysa-n
  • molecular-weight:
    • 661.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality