Difference between revisions of "PWY-5856"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
 
* common-name:
 
* common-name:
** ubiquinol-7
+
** ω-saturated c55 dolichol phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** pfiusppkanbdhq-rjyqsxaysa-n
+
** ktgsdhzxakcyhm-lstwdcehsa-l
 
* molecular-weight:
 
* molecular-weight:
** 661.019
+
** 849.311
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9229]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-7}}
+
{{#set: common-name=ω-saturated c55 dolichol phosphate}}
{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
+
{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
{{#set: molecular-weight=661.019}}
+
{{#set: molecular-weight=849.311}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-17858

  • common-name:
    • ω-saturated c55 dolichol phosphate
  • smiles:
    • cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
  • inchi-key:
    • ktgsdhzxakcyhm-lstwdcehsa-l
  • molecular-weight:
    • 849.311

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality