Difference between revisions of "PWY-5857"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-3S-Hydroxyacyl-CoAs Long-Chain-3S-Hydroxyacyl-CoAs] ==
 * common-name:
-** prostaglandin d2
+** a long-chain (3s)-3-hydroxyacyl-coa
-* smiles:
-** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
-* inchi-key:
-** bhmbvrspmrccgg-outuxvnysa-m
-* molecular-weight:
-** 351.462
 == Reaction(s) known to consume the compound ==
-* [[1.1.1.188-RXN]]
+* [[1.1.1.211-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[1.1.1.188-RXN]]
+* [[1.1.1.211-RXN]]
-* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=prostaglandin d2}}
+{{#set: common-name=a long-chain (3s)-3-hydroxyacyl-coa}}
-{{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}}
-{{#set: molecular-weight=351.462}}