Difference between revisions of "PWY-5891"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * common-name: ** lotaustralin * smiles: ** ccc(oc1(oc(co)c(o)c(o)c(o)1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] ==
 
* common-name:
 
* common-name:
** lotaustralin
+
** l-alanyl-glycine
 
* smiles:
 
* smiles:
** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
+
** cc([n+])c(ncc([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** wewbwvmtoyuphh-qhaqebjbsa-n
+
** cxispyvymqwfle-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 261.274
+
** 146.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9674]]
+
* [[RXN0-6977]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13603]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lotaustralin}}
+
{{#set: common-name=l-alanyl-glycine}}
{{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}}
+
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
{{#set: molecular-weight=261.274}}
+
{{#set: molecular-weight=146.146}}

Revision as of 14:19, 26 August 2019

Metabolite ALA-GLY

  • common-name:
    • l-alanyl-glycine
  • smiles:
    • cc([n+])c(ncc([o-])=o)=o
  • inchi-key:
    • cxispyvymqwfle-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality