Difference between revisions of "PWY-5901"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+== Pathway PWY-5901 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** thyroxine sulfate
+** 2,3-dihydroxybenzoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+* [[DHBDEHYD-RXN]]
-* inchi-key:
+* [[ISOCHORSYN-RXN]]
-** qyxijuzwssqict-lbprgkrzsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneISOCHORMAT-RXN ISOCHORMAT-RXN]
-** 855.924
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=2,3-dihydroxybenzoate biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-10614]]
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=thyroxine sulfate}}
-{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
-{{#set: molecular-weight=855.924}}