Difference between revisions of "PWY-5901"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+== Pathway PWY-7579 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** thyroxine sulfate
+** phycourobilin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+* [[1.3.7.2-RXN]]
-* inchi-key:
+* [[1.3.7.3-RXN]]
-** qyxijuzwssqict-lbprgkrzsa-m
+* [[RXN-17523]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 855.924
+* [NoneRXN-15990 RXN-15990]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-15985 RXN-15985]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1117}}
-* [[RXN-10614]]
+{{#set: common-name=phycourobilin biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=3}}
-{{#set: common-name=thyroxine sulfate}}
+{{#set: completion rate=0.6}}
-{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=855.924}}