Difference between revisions of "PWY-5912"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] ==
+== Pathway PWY-5912 ==
+* taxonomic-range:
+** tax-4479
 * common-name:
-** lipoyl-adenylate
+** 2'-deoxymugineic acid phytosiderophore biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
+* [[S-ADENMETSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** qwegocjrzoksoe-aduakinbsa-m
+* [None2.6.1.80-RXN 2.6.1.80-RXN]
-* molecular-weight:
+* [None2.5.1.43-RXN 2.5.1.43-RXN]
-** 534.518
+* [None1.1.1.285-RXN 1.1.1.285-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4479}}
-* [[RXN-13039]]
+{{#set: common-name=2'-deoxymugineic acid phytosiderophore biosynthesis}}
-* [[RXN-8655]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.25}}
-* [[RXN-8654]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=lipoyl-adenylate}}
-{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
-{{#set: molecular-weight=534.518}}