Difference between revisions of "PWY-5913"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** c...")
(Created page with "Category:pathway == Pathway PWY-5913 == * taxonomic-range: ** tax-1118 ** tax-1213 ** tax-1224 * common-name: ** partial tca cycle (obligate autotrophs) == Reaction(s) fou...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] ==
+
== Pathway PWY-5913 ==
 +
* taxonomic-range:
 +
** tax-1118
 +
** tax-1213
 +
** tax-1224
 
* common-name:
 
* common-name:
−
** dihydrogeranylgeranyl bacteriopheophytin
+
** partial tca cycle (obligate autotrophs)
−
* smiles:
+
== Reaction(s) found ==
−
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+
* [[ACONITATEDEHYDR-RXN]]
−
* inchi-key:
+
* [[ACONITATEHYDR-RXN]]
−
** fzuvlshmhogmop-xqjlcrkzsa-n
+
* [[ASPAMINOTRANS-RXN]]
−
* molecular-weight:
+
* [[CITSYN-RXN]]
−
** 884.189
+
* [[FUMHYDR-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[GLUTDEHYD-RXN]]
−
* [[RXN-8795]]
+
* [[ISOCITDEH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
* [[MALATE-DEH-RXN]]
−
* [[RXN-8794]]
+
* [[PEPCARBOX-RXN]]
−
== Reaction(s) of unknown directionality ==
+
* [[SUCCCOASYN-RXN]]
−
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+
== Reaction(s) not found ==
−
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
+
* [NoneRXN-14971 RXN-14971]
−
{{#set: molecular-weight=884.189}}
+
* [NoneMALATE-DEHYDROGENASE-ACCEPTOR-RXN MALATE-DEHYDROGENASE-ACCEPTOR-RXN]
 +
{{#set: taxonomic-range=tax-1213|tax-1118|tax-1224}}
 +
{{#set: common-name=partial tca cycle (obligate autotrophs)}}
 +
{{#set: nb reaction found=10}}
 +
{{#set: completion rate=1.25}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5913

  • taxonomic-range:
    • tax-1118
    • tax-1213
    • tax-1224
  • common-name:
    • partial tca cycle (obligate autotrophs)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14971 RXN-14971]
  • [NoneMALATE-DEHYDROGENASE-ACCEPTOR-RXN MALATE-DEHYDROGENASE-ACCEPTOR-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-5913&oldid=130851"