Difference between revisions of "PWY-5913"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] == * common-name: ** a reduced glutaredoxin == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl bacteriopheophytin
+
** a reduced glutaredoxin
* smiles:
 
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
** fzuvlshmhogmop-xqjlcrkzsa-n
 
* molecular-weight:
 
** 884.189
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8795]]
+
* [[RXN-982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8794]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=a reduced glutaredoxin}}
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
 
{{#set: molecular-weight=884.189}}
 

Revision as of 09:22, 27 August 2019

Metabolite Red-Glutaredoxins

  • common-name:
    • a reduced glutaredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality