Difference between revisions of "PWY-5915"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15370 CPD-15370] == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * common-name: ** nicotine-glucuronide * smiles: ** c1(cc[ch]([n+](c)1)c3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15370 CPD-15370] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
 
* common-name:
 
* common-name:
** trans-lesqueroloyl-coa
+
** nicotine-glucuronide
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
 
* inchi-key:
 
* inchi-key:
** fgrjeqcmqcquqf-fscwmumrsa-j
+
** sawaiuljdyflpd-soafeqhcsa-o
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 339.367
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14494]]
+
* [[RXN66-83]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-lesqueroloyl-coa}}
+
{{#set: common-name=nicotine-glucuronide}}
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
+
{{#set: inchi-key=inchikey=sawaiuljdyflpd-soafeqhcsa-o}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=339.367}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-2744

  • common-name:
    • nicotine-glucuronide
  • smiles:
    • c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
  • inchi-key:
    • sawaiuljdyflpd-soafeqhcsa-o
  • molecular-weight:
    • 339.367

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality