Difference between revisions of "PWY-5917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORHODOPSIN PHOSPHORHODOPSIN] == * common-name: ** a phosphorhodopsin == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORHODOPSIN PHOSPHORHODOPSIN] ==
 
* common-name:
 
* common-name:
** hercynine
+
** a phosphorhodopsin
* smiles:
 
** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
 
* inchi-key:
 
** gppytcrvkhuljh-qmmmgpobsa-n
 
* molecular-weight:
 
** 197.236
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14430]]
+
* [[2.7.11.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.11.14-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hercynine}}
+
{{#set: common-name=a phosphorhodopsin}}
{{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}}
 
{{#set: molecular-weight=197.236}}
 

Revision as of 09:22, 27 August 2019

Metabolite PHOSPHORHODOPSIN

  • common-name:
    • a phosphorhodopsin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality