Difference between revisions of "PWY-5921"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == * common-name: ** leukotrie...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] == * common-name: ** mature trna == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] ==
 
* common-name:
 
* common-name:
** leukotriene b4
+
** mature trna
* smiles:
 
** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
 
* inchi-key:
 
** vnyssyrcgwbhlg-amolwhmgsa-m
 
* molecular-weight:
 
** 335.462
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+
* [[3.1.26.11-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene b4}}
+
{{#set: common-name=mature trna}}
{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}
 
{{#set: molecular-weight=335.462}}
 

Revision as of 09:22, 27 August 2019

Metabolite mature-tRNA

  • common-name:
    • mature trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality