Difference between revisions of "PWY-5938"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-LIPOYLLYSINE PROTEIN-LIPOYLLYSINE] == * common-name: ** a [glycine-cleavage complex h p...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-LIPOYLLYSINE PROTEIN-LIPOYLLYSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] ==
 
* common-name:
 
* common-name:
** a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine
+
** ribose-1-arsenate
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
 +
* inchi-key:
 +
** ryjjomqpaaufbf-txicztdvsa-l
 +
* molecular-weight:
 +
** 272.043
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GCVP-RXN]]
 
* [[RXN-8629]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GCVP-RXN]]
+
* [[RXN-7001]]
* [[RXN-13039]]
 
* [[RXN-14950]]
 
* [[RXN-8629]]
 
* [[RXN0-1141]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine}}
+
{{#set: common-name=ribose-1-arsenate}}
 +
{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
 +
{{#set: molecular-weight=272.043}}

Revision as of 14:19, 26 August 2019

Metabolite RIBOSE-1-ARSENATE

  • common-name:
    • ribose-1-arsenate
  • smiles:
    • c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
  • inchi-key:
    • ryjjomqpaaufbf-txicztdvsa-l
  • molecular-weight:
    • 272.043

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality