Difference between revisions of "PWY-5938"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-114 CPD1F-114] ==
+== Pathway PWY-6978 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** all-trans-lycopene
+** plastoquinol-9 biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
+* [[RXN-2762]]
-* inchi-key:
+== Reaction(s) not found ==
-** oaijszizwzsqbc-gyzmgtaesa-n
+* [NoneRXN-15308 RXN-15308]
-* molecular-weight:
+* [None2.5.1.39-RXN 2.5.1.39-RXN]
-** 536.882
+* [NoneRXN-9238 RXN-9238]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12944 RXN-12944]
-* [[RXN1F-150]]
+{{#set: taxonomic-range=tax-1117}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=plastoquinol-9 biosynthesis ii}}
-* [[RXN-8042]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.2}}
-{{#set: common-name=all-trans-lycopene}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
-{{#set: molecular-weight=536.882}}