Difference between revisions of "PWY-5938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-114 CPD1F-114] == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-114 CPD1F-114] == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-lycopene |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oaijszizwzsqbc-gyzmgtaesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1F-150]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8042]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-lycopene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD1F-114
- common-name:
- all-trans-lycopene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
- inchi-key:
- oaijszizwzsqbc-gyzmgtaesa-n
- molecular-weight:
- 536.882
