Difference between revisions of "PWY-5941"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] ==
+== Pathway PWY-5941 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
+** tax-33154
 * common-name:
-** (2r,3s)-3-isopropylmalate
+** glycogen degradation ii
-* smiles:
+== Reaction(s) found ==
-** cc(c)c(c([o-])=o)c(c([o-])=o)o
+* [[GLYCOPHOSPHORYL-RXN]]
-* inchi-key:
+* [[PHOSPHOGLUCMUT-RXN]]
-** rnqhmtfbussbjq-crclsjgqsa-l
+* [[RXN-9025]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 174.153
+* [NoneRXN-19947 RXN-19947]
-== Reaction(s) known to consume the compound ==
+* [NoneGLUCOKIN-RXN GLUCOKIN-RXN]
-* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+* [NoneRXN-9024 RXN-9024]
-* [[IMDH]]
+{{#set: taxonomic-range=tax-33154|tax-2|tax-2157}}
-* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
+{{#set: common-name=glycogen degradation ii}}
-* [[RXN-13158]]
+{{#set: nb reaction found=3}}
-* [[RXN-13163]]
+{{#set: completion rate=0.5}}
-* [[RXN-8991]]
+{{#set: nb total reaction=6}}
-== Reaction(s) known to produce the compound ==
-* [[3-ISOPROPYLMALDEHYDROG-RXN]]
-* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
-* [[RXN-13163]]
-* [[RXN-8991]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2r,3s)-3-isopropylmalate}}
-{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}
-{{#set: molecular-weight=174.153}}