Difference between revisions of "PWY-5951"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == * common-name: ** 5',5'''-dia...")
(Created page with "Category:pathway == Pathway PWY-5951 == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** (r,r)-butanediol biosynthesis == Reaction(s) found == * RR-BUTANEDIOL-D...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] ==
+
== Pathway PWY-5951 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** 5',5'''-diadenosine triphosphate
+
** (r,r)-butanediol biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** qcicupzzliqapa-xpwfqurosa-k
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-2}}
** 753.388
+
{{#set: common-name=(r,r)-butanediol biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=5',5'''-diadenosine triphosphate}}
 
{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
 
{{#set: molecular-weight=753.388}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5951

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • (r,r)-butanediol biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present