Difference between revisions of "PWY-5958"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] ==
+== Pathway PWY-5958 ==
+* taxonomic-range:
+** tax-16739
+** tax-23513
 * common-name:
-** cytidine 2',3'-cyclic monophosphate
+** acridone alkaloid biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
+* [[ANTHRANSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** nmpzcczxcomsdq-xvfcmesisa-m
+* [NoneRXN-9504 RXN-9504]
-* molecular-weight:
+* [NoneANTHRANILATE-N-METHYLTRANSFERASE-RXN ANTHRANILATE-N-METHYLTRANSFERASE-RXN]
-** 304.176
+* [None2.3.1.159-RXN 2.3.1.159-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-16739|tax-23513}}
-* [[RXN-12059]]
+{{#set: common-name=acridone alkaloid biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
-{{#set: molecular-weight=304.176}}