Difference between revisions of "PWY-5958"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] ==
+== Pathway PWY-5958 ==
+* taxonomic-range:
+** tax-16739
+** tax-23513
 * common-name:
-** d-ribulose 5-phosphate
+** acridone alkaloid biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
+* [[ANTHRANSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fnzlkvnuwiipsj-uhnvwzdzsa-l
+* [NoneRXN-9504 RXN-9504]
-* molecular-weight:
+* [NoneANTHRANILATE-N-METHYLTRANSFERASE-RXN ANTHRANILATE-N-METHYLTRANSFERASE-RXN]
-** 228.095
+* [None2.3.1.159-RXN 2.3.1.159-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-16739|tax-23513}}
-* [[DIOHBUTANONEPSYN-RXN]]
+{{#set: common-name=acridone alkaloid biosynthesis}}
-* [[PHOSPHORIBULOKINASE-RXN]]
+{{#set: nb reaction found=1}}
-* [[RIB5PISOM-RXN]]
+{{#set: completion rate=0.25}}
-* [[RIBULP3EPIM-RXN]]
+{{#set: nb total reaction=4}}
-== Reaction(s) known to produce the compound ==
-* [[6PGLUCONDEHYDROG-RXN]]
-* [[PHOSPHORIBULOKINASE-RXN]]
-* [[RIB5PISOM-RXN]]
-* [[RIBULP3EPIM-RXN]]
-* [[RXN-3341]]
-* [[RXN-9952]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=d-ribulose 5-phosphate}}
-{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
-{{#set: molecular-weight=228.095}}