Difference between revisions of "PWY-5958"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylic-Acid-Amides Monocarboxylic-Acid-Amides] == * common-name: ** a monocarboxylic ac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylic-Acid-Amides Monocarboxylic-Acid-Amides] ==
 
* common-name:
 
* common-name:
** d-ribulose 5-phosphate
+
** a monocarboxylic acid amide
* smiles:
 
** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
** fnzlkvnuwiipsj-uhnvwzdzsa-l
 
* molecular-weight:
 
** 228.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[AMIDASE-RXN]]
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6PGLUCONDEHYDROG-RXN]]
 
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
* [[RXN-3341]]
 
* [[RXN-9952]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribulose 5-phosphate}}
+
{{#set: common-name=a monocarboxylic acid amide}}
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Revision as of 09:22, 27 August 2019

Metabolite Monocarboxylic-Acid-Amides

  • common-name:
    • a monocarboxylic acid amide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality