Difference between revisions of "PWY-5958"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] ==
 * common-name:
-** cytidine 2',3'-cyclic monophosphate
+** d-ribulose 5-phosphate
 * smiles:
-** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
+** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
 * inchi-key:
-** nmpzcczxcomsdq-xvfcmesisa-m
+** fnzlkvnuwiipsj-uhnvwzdzsa-l
 * molecular-weight:
-** 304.176
+** 228.095
 == Reaction(s) known to consume the compound ==
-* [[RXN-12059]]
+* [[DIOHBUTANONEPSYN-RXN]]
+* [[PHOSPHORIBULOKINASE-RXN]]
+* [[RIB5PISOM-RXN]]
+* [[RIBULP3EPIM-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[6PGLUCONDEHYDROG-RXN]]
+* [[PHOSPHORIBULOKINASE-RXN]]
+* [[RIB5PISOM-RXN]]
+* [[RIBULP3EPIM-RXN]]
+* [[RXN-3341]]
+* [[RXN-9952]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+{{#set: common-name=d-ribulose 5-phosphate}}
-{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
+{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
-{{#set: molecular-weight=304.176}}
+{{#set: molecular-weight=228.095}}