Difference between revisions of "PWY-5966"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=...")
 
(Created page with "Category:pathway == Pathway PWY-5966 == * taxonomic-range: ** tax-33084 ** tax-33208 ** tax-4751 ** tax-2 * common-name: ** fatty acid biosynthesis initiation ii == Reacti...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] ==
+
== Pathway PWY-5966 ==
 +
* taxonomic-range:
 +
** tax-33084
 +
** tax-33208
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** oxaloacetate
+
** fatty acid biosynthesis initiation ii
* smiles:
+
== Reaction(s) found ==
** c(c([o-])=o)c(=o)c([o-])=o
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
* inchi-key:
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
** khpxuqmniqbqev-uhfffaoysa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
** 130.057
+
{{#set: taxonomic-range=tax-4751|tax-33208|tax-2|tax-33084}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=fatty acid biosynthesis initiation ii}}
* [[ASPAMINOTRANS-RXN]]
+
{{#set: nb reaction found=2}}
* [[CITSYN-RXN]]
+
{{#set: completion rate=n.a}}
* [[CSm]]
+
{{#set: nb total reaction=n.a}}
* [[MALATE-DEH-RXN]]
 
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 
* [[OAAAKGtm]]
 
* [[OAACITtm]]
 
* [[OXALODECARB-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOXYKIN-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN-2464]]
 
== Reaction(s) known to produce the compound ==
 
* [[ASPAMINOTRANS-RXN]]
 
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPCL]]
 
* [[MALATE-DEH-RXN]]
 
* [[OAAAKGtm]]
 
* [[OAACITtm]]
 
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOX-RXN]]
 
* [[PPC]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN-2464]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=oxaloacetate}}
 
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
 
{{#set: molecular-weight=130.057}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5966

  • taxonomic-range:
    • tax-33084
    • tax-33208
    • tax-4751
    • tax-2
  • common-name:
    • fatty acid biosynthesis initiation ii

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available