Difference between revisions of "PWY-5966"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] == * common-name: ** a diphthine-[translation elongation factor 2] == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] ==
 
* common-name:
 
* common-name:
** oxaloacetate
+
** a diphthine-[translation elongation factor 2]
* smiles:
 
** c(c([o-])=o)c(=o)c([o-])=o
 
* inchi-key:
 
** khpxuqmniqbqev-uhfffaoysa-l
 
* molecular-weight:
 
** 130.057
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPAMINOTRANS-RXN]]
+
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
* [[CITSYN-RXN]]
 
* [[CSm]]
 
* [[MALATE-DEH-RXN]]
 
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 
* [[OAAAKGtm]]
 
* [[OAACITtm]]
 
* [[OXALODECARB-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOXYKIN-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN-2464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPAMINOTRANS-RXN]]
+
* [[RXN-11373]]
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
* [[RXN-14326]]
* [[ATPCL]]
+
* [[RXN-15776]]
* [[MALATE-DEH-RXN]]
 
* [[OAAAKGtm]]
 
* [[OAACITtm]]
 
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOX-RXN]]
 
* [[PPC]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN-2464]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxaloacetate}}
+
{{#set: common-name=a diphthine-[translation elongation factor 2]}}
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
 
{{#set: molecular-weight=130.057}}
 

Revision as of 14:19, 26 August 2019

Metabolite DIPHTINE

  • common-name:
    • a diphthine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a diphthine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.