Difference between revisions of "PWY-5972"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
(Created page with "Category:pathway == Pathway PWY-5972 == * taxonomic-range: ** tax-33154 ** tax-2 * common-name: ** stearate biosynthesis i (animals and fungi) == Reaction(s) found == * ...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] ==
+
== Pathway PWY-5972 ==
 +
* taxonomic-range:
 +
** tax-33154
 +
** tax-2
 
* common-name:
 
* common-name:
** imp
+
** stearate biosynthesis i (animals and fungi)
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
* [[RXN-9543]]
* inchi-key:
+
* [[RXN-9545]]
** grszfwquakgdav-kqynxxcusa-l
+
* [[RXN-9623]]
* molecular-weight:
+
* [[RXN-9624]]
** 346.193
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-9544 RXN-9544]
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [NoneRXN-9546 RXN-9546]
* [[HPRT]]
+
{{#set: taxonomic-range=tax-33154|tax-2}}
* [[I5NT]]
+
{{#set: common-name=stearate biosynthesis i (animals and fungi)}}
* [[IMP-DEHYDROG-RXN]]
+
{{#set: nb reaction found=4}}
* [[IMPCYCLOHYDROLASE-RXN]]
+
{{#set: completion rate=0.67}}
* [[RXN-7607]]
+
{{#set: nb total reaction=6}}
== Reaction(s) known to produce the compound ==
 
* [[AMP-DEAMINASE-RXN]]
 
* [[GMP-REDUCT-RXN]]
 
* [[HPRT]]
 
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[ITPP]]
 
* [[RXN-14003]]
 
* [[RXN0-6382]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=imp}}
 
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 
{{#set: molecular-weight=346.193}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5972

  • taxonomic-range:
    • tax-33154
    • tax-2
  • common-name:
    • stearate biosynthesis i (animals and fungi)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9544 RXN-9544]
  • [NoneRXN-9546 RXN-9546]