Difference between revisions of "PWY-5972"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2183 CPD-2183] == * common-name: ** 1-oleoyl-2-palmitoyl-phosphatidylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2183 CPD-2183] ==
 
* common-name:
 
* common-name:
** imp
+
** 1-oleoyl-2-palmitoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** grszfwquakgdav-kqynxxcusa-l
+
** gtckewvhtggusn-hgwhepcssa-m
 
* molecular-weight:
 
* molecular-weight:
** 346.193
+
** 748.008
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[RXN-1725]]
* [[HPRT]]
 
* [[I5NT]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[RXN-7607]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMP-DEAMINASE-RXN]]
+
* [[RXN-13313]]
* [[GMP-REDUCT-RXN]]
 
* [[HPRT]]
 
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[ITPP]]
 
* [[RXN-14003]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imp}}
+
{{#set: common-name=1-oleoyl-2-palmitoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=gtckewvhtggusn-hgwhepcssa-m}}
{{#set: molecular-weight=346.193}}
+
{{#set: molecular-weight=748.008}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-2183

  • common-name:
    • 1-oleoyl-2-palmitoyl-phosphatidylglycerol
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • gtckewvhtggusn-hgwhepcssa-m
  • molecular-weight:
    • 748.008

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality