Difference between revisions of "PWY-5987"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] ==
+== Pathway PWY-5987 ==
+* taxonomic-range:
+** tax-4557
 * common-name:
-** d-myo-inositol (1,4,5)-trisphosphate
+** sorgoleone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
+* [[RXN-10664]]
-* inchi-key:
+* [[RXN-9616]]
-** mmwciqzxvozegg-xjtpdsdzsa-h
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-9620 RXN-9620]
-** 414.049
+* [NoneRXN-9621 RXN-9621]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11378 RXN-11378]
-* [[2.7.1.127-RXN]]
+* [NoneRXN-9618 RXN-9618]
-* [[2.7.1.151-RXN]]
+* [NoneRXN-9617 RXN-9617]
-* [[3.1.3.56-RXN]]
+* [NoneRXN-9619 RXN-9619]
-* [[RXN-10948]]
+{{#set: taxonomic-range=tax-4557}}
-* [[RXN-13197]]
+{{#set: common-name=sorgoleone biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[3.1.4.11-RXN]]
+{{#set: completion rate=0.25}}
-* [[RXN-10948]]
+{{#set: nb total reaction=8}}
-* [[RXN-13197]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
-{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
-{{#set: molecular-weight=414.049}}