Difference between revisions of "PWY-5987"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+* smiles:
+** c(c(nc(c(o)=o)[r])=o)n
 * common-name:
-** d-myo-inositol (1,4,5)-trisphosphate
+** glycyl-peptide
-* smiles:
-** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
-* inchi-key:
-** mmwciqzxvozegg-xjtpdsdzsa-h
-* molecular-weight:
-** 414.049
 == Reaction(s) known to consume the compound ==
-* [[2.7.1.127-RXN]]
+* [[2.3.1.97-RXN]]
-* [[2.7.1.151-RXN]]
-* [[3.1.3.56-RXN]]
-* [[RXN-10948]]
-* [[RXN-13197]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.4.11-RXN]]
-* [[RXN-10948]]
-* [[RXN-13197]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
+{{#set: common-name=glycyl-peptide}}
-{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
-{{#set: molecular-weight=414.049}}