Difference between revisions of "PWY-5994"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([...")
 
(Created page with "Category:pathway == Pathway PWY-5994 == * taxonomic-range: ** tax-33154 * common-name: ** palmitate biosynthesis i (animals and fungi) == Reaction(s) found == <div class="...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] ==
+
== Pathway PWY-5994 ==
 +
* taxonomic-range:
 +
** tax-33154
 
* common-name:
 
* common-name:
−
** l-alanyl-l-glutamine
+
** palmitate biosynthesis i (animals and fungi)
−
* smiles:
+
== Reaction(s) found ==
−
** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* inchi-key:
+
* [[3.1.2.21-RXN]]
−
** hjcmdxdypoufdy-whfbiakzsa-n
+
* [[4.2.1.58-RXN]]
−
* molecular-weight:
+
* [[4.2.1.59-RXN]]
−
** 217.224
+
* [[4.2.1.61-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[PALMITOYL-COA-HYDROLASE-RXN]]
−
* [[RXN0-6976]]
+
* [[RXN-9514]]
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-9515]]
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-9518]]
−
{{#set: common-name=l-alanyl-l-glutamine}}
+
* [[RXN-9520]]
−
{{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}}
+
* [[RXN-9521]]
−
{{#set: molecular-weight=217.224}}
+
* [[RXN-9524]]
 +
* [[RXN-9526]]
 +
* [[RXN-9528]]
 +
* [[RXN-9530]]
 +
* [[RXN-9532]]
 +
* [[RXN-9533]]
 +
* [[RXN-9534]]
 +
* [[RXN-9536]]
 +
* [[RXN-9537]]
 +
* [[RXN-9538]]
 +
* [[RXN-9540]]
 +
* [[RXN-9542]]
 +
* [[RXN-9549]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN-9655]]
 +
* [[RXN3O-9780]]
 +
</div>
 +
== Reaction(s) not found ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [NoneRXN-21717 RXN-21717]
 +
* [NoneRXN66-616 RXN66-616]
 +
* [NoneRXN66-636 RXN66-636]
 +
* [NoneRXN66-614 RXN66-614]
 +
* [NoneRXN66-643 RXN66-643]
 +
* [NoneRXN66-628 RXN66-628]
 +
* [NoneRXN66-627 RXN66-627]
 +
* [NoneRXN66-638 RXN66-638]
 +
* [NoneRXN66-639 RXN66-639]
 +
* [NoneRXN66-622 RXN66-622]
 +
* [NoneRXN66-618 RXN66-618]
 +
* [NoneRXN66-619 RXN66-619]
 +
* [NoneRXN66-617 RXN66-617]
 +
* [NoneRXN66-626 RXN66-626]
 +
* [NoneRXN66-625 RXN66-625]
 +
* [NoneRXN66-640 RXN66-640]
 +
* [NoneRXN66-631 RXN66-631]
 +
* [NoneRXN66-634 RXN66-634]
 +
* [NoneRXN66-642 RXN66-642]
 +
* [NoneRXN66-624 RXN66-624]
 +
* [NoneRXN66-635 RXN66-635]
 +
* [NoneRXN66-623 RXN66-623]
 +
* [NoneRXN66-637 RXN66-637]
 +
* [NoneRXN66-633 RXN66-633]
 +
* [NoneRXN66-632 RXN66-632]
 +
* [NoneRXN66-629 RXN66-629]
 +
* [NoneRXN66-621 RXN66-621]
 +
* [NoneRXN66-644 RXN66-644]
 +
* [NoneRXN66-620 RXN66-620]
 +
* [NoneRXN66-641 RXN66-641]
 +
* [NoneRXN66-630 RXN66-630]
 +
</div>
 +
{{#set: taxonomic-range=tax-33154}}
 +
{{#set: common-name=palmitate biosynthesis i (animals and fungi)}}
 +
{{#set: nb reaction found=31}}
 +
{{#set: completion rate=1.0}}
 +
{{#set: nb total reaction=31}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5994

  • taxonomic-range:
    • tax-33154
  • common-name:
    • palmitate biosynthesis i (animals and fungi)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-21717 RXN-21717]
  • [NoneRXN66-616 RXN66-616]
  • [NoneRXN66-636 RXN66-636]
  • [NoneRXN66-614 RXN66-614]
  • [NoneRXN66-643 RXN66-643]
  • [NoneRXN66-628 RXN66-628]
  • [NoneRXN66-627 RXN66-627]
  • [NoneRXN66-638 RXN66-638]
  • [NoneRXN66-639 RXN66-639]
  • [NoneRXN66-622 RXN66-622]
  • [NoneRXN66-618 RXN66-618]
  • [NoneRXN66-619 RXN66-619]
  • [NoneRXN66-617 RXN66-617]
  • [NoneRXN66-626 RXN66-626]
  • [NoneRXN66-625 RXN66-625]
  • [NoneRXN66-640 RXN66-640]
  • [NoneRXN66-631 RXN66-631]
  • [NoneRXN66-634 RXN66-634]
  • [NoneRXN66-642 RXN66-642]
  • [NoneRXN66-624 RXN66-624]
  • [NoneRXN66-635 RXN66-635]
  • [NoneRXN66-623 RXN66-623]
  • [NoneRXN66-637 RXN66-637]
  • [NoneRXN66-633 RXN66-633]
  • [NoneRXN66-632 RXN66-632]
  • [NoneRXN66-629 RXN66-629]
  • [NoneRXN66-621 RXN66-621]
  • [NoneRXN66-644 RXN66-644]
  • [NoneRXN66-620 RXN66-620]
  • [NoneRXN66-641 RXN66-641]
  • [NoneRXN66-630 RXN66-630]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-5994&oldid=130962"