Difference between revisions of "PWY-5994"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiols Thiols] == * common-name: ** a thiol == Reaction(s) known to consume the compound == * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiols Thiols] ==
 
* common-name:
 
* common-name:
** l-alanyl-l-glutamine
+
** a thiol
* smiles:
 
** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
 
* inchi-key:
 
** hjcmdxdypoufdy-whfbiakzsa-n
 
* molecular-weight:
 
** 217.224
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6976]]
+
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15582]]
 +
* [[RXN-6763]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-glutamine}}
+
{{#set: common-name=a thiol}}
{{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}}
 
{{#set: molecular-weight=217.224}}
 

Revision as of 14:19, 26 August 2019

Metabolite Thiols

  • common-name:
    • a thiol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality