Difference between revisions of "PWY-5995"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c...")
(Created page with "Category:pathway == Pathway PWY-5995 == * taxonomic-range: ** tax-33090 * common-name: ** linoleate biosynthesis i (plants) == Reaction(s) found == * RXN-16045 * RXN...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Pathway PWY-5995 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** shikimate 3-phosphate
+
** linoleate biosynthesis i (plants)
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
+
* [[RXN-16045]]
* inchi-key:
+
* [[RXN-9669]]
** qyojskgcwnakgw-pbxrrbtrsa-k
+
* [[RXN-9670]]
* molecular-weight:
+
== Reaction(s) not found ==
** 251.109
+
* [NoneRXN-16036 RXN-16036]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090}}
* [[2.5.1.19-RXN]]
+
{{#set: common-name=linoleate biosynthesis i (plants)}}
* [[SHIKIMATE-KINASE-RXN]]
+
{{#set: nb reaction found=3}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.75}}
* [[2.5.1.19-RXN]]
+
{{#set: nb total reaction=4}}
* [[SHIKIMATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=shikimate 3-phosphate}}
 
{{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}}
 
{{#set: molecular-weight=251.109}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-5995

  • taxonomic-range:
    • tax-33090
  • common-name:
    • linoleate biosynthesis i (plants)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16036 RXN-16036]