Difference between revisions of "PWY-5995"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-serines Protein-L-serines] == * common-name: ** a [protein]-l-serine == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** shikimate 3-phosphate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) | ||
| + | * inchi-key: | ||
| + | ** qyojskgcwnakgw-pbxrrbtrsa-k | ||
| + | * molecular-weight: | ||
| + | ** 251.109 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2. | + | * [[2.5.1.19-RXN]] |
| − | * [[ | + | * [[SHIKIMATE-KINASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2. | + | * [[2.5.1.19-RXN]] |
| − | * [[ | + | * [[SHIKIMATE-KINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=shikimate 3-phosphate}} |
| + | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} | ||
| + | {{#set: molecular-weight=251.109}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite SHIKIMATE-5P
- common-name:
- shikimate 3-phosphate
- smiles:
- c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
- inchi-key:
- qyojskgcwnakgw-pbxrrbtrsa-k
- molecular-weight:
- 251.109
