Difference between revisions of "PWY-5997"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL 2-CARBOXY-D-ARABINITOL] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] ==
 * common-name:
-** 2-carboxy-d-arabinitol
+** all-trans-retinol
 * smiles:
-** c(c(c(c(c([o-])=o)(co)o)o)o)o
+** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 * inchi-key:
-** xondrgralztvkd-zmizwqjlsa-m
+** fpipgxgpppqfeq-ovsjkpmpsa-n
 * molecular-weight:
-** 195.149
+** 286.456
 == Reaction(s) known to consume the compound ==
+* [[1.3.99.23-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12547]]
 == Reaction(s) known to produce the compound ==
-* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+* [[3.1.1.64-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12575]]
+* [[RXN-12579]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-carboxy-d-arabinitol}}
+{{#set: common-name=all-trans-retinol}}
-{{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}}
+{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
-{{#set: molecular-weight=195.149}}
+{{#set: molecular-weight=286.456}}