Difference between revisions of "PWY-5997"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acetoacetyl-ACPs Acetoacetyl-ACPs] == * common-name: ** an acetoacetyl-[acp] == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acetoacetyl-ACPs Acetoacetyl-ACPs] ==
 
* common-name:
 
* common-name:
** all-trans-retinol
+
** an acetoacetyl-[acp]
* smiles:
 
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 
* inchi-key:
 
** fpipgxgpppqfeq-ovsjkpmpsa-n
 
* molecular-weight:
 
** 286.456
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.99.23-RXN]]
+
* [[RXN-9514]]
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12547]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
+
* [[2.3.1.180-RXN]]
* [[RETINOL-DEHYDROGENASE-RXN]]
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12575]]
 
* [[RXN-12579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-retinol}}
+
{{#set: common-name=an acetoacetyl-[acp]}}
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
 
{{#set: molecular-weight=286.456}}
 

Revision as of 09:22, 27 August 2019

Metabolite Acetoacetyl-ACPs

  • common-name:
    • an acetoacetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetoacetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.