Difference between revisions of "PWY-6001"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] == * common-name: ** an n-acylated amino acid ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-tetradecenoyl-coa
+
** an n-acylated amino acid
* smiles:
 
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** bepllrgjvxaeji-twafkmgksa-j
 
* molecular-weight:
 
** 985.829
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17795]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17794]]
+
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=an n-acylated amino acid}}
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
 
{{#set: molecular-weight=985.829}}
 

Revision as of 09:22, 27 August 2019

Metabolite N-Acylated-Amino-Acids

  • common-name:
    • an n-acylated amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality