Difference between revisions of "PWY-6002"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] == * common-name: ** preuroporphyrinogen * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TusE-L-cysteine TusE-L-cysteine] == * common-name: ** a [tuse sulfur carrier protein]-l-cystein...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TusE-L-cysteine TusE-L-cysteine] ==
 
* common-name:
 
* common-name:
** preuroporphyrinogen
+
** a [tuse sulfur carrier protein]-l-cysteine
* smiles:
 
** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
 
* inchi-key:
 
** wdfjyrzcziubpr-uhfffaoysa-f
 
* molecular-weight:
 
** 846.757
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UROGENIIISYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETHYLBILANESYN-RXN]]
+
* [[RXN0-2023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preuroporphyrinogen}}
+
{{#set: common-name=a [tuse sulfur carrier protein]-l-cysteine}}
{{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}}
 
{{#set: molecular-weight=846.757}}
 

Revision as of 09:22, 27 August 2019

Metabolite TusE-L-cysteine

  • common-name:
    • a [tuse sulfur carrier protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.