Difference between revisions of "PWY-6019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * common-name: ** 5-a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] ==
 
* common-name:
 
* common-name:
** red chlorophyll catabolite
+
** 5-amino-6-(d-ribitylamino)uracil
 
* smiles:
 
* smiles:
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** gvtpycxgtfqzdt-yssugppcsa-m
+
** xkqzixvjvupore-rpdrrwsusa-n
 
* molecular-weight:
 
* molecular-weight:
** 624.692
+
** 276.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7741]]
+
* [[LUMAZINESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7740]]
+
* [[RIBOFLAVIN-SYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=red chlorophyll catabolite}}
+
{{#set: common-name=5-amino-6-(d-ribitylamino)uracil}}
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
+
{{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}}
{{#set: molecular-weight=624.692}}
+
{{#set: molecular-weight=276.249}}

Revision as of 14:18, 26 August 2019

Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE

  • common-name:
    • 5-amino-6-(d-ribitylamino)uracil
  • smiles:
    • c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
  • inchi-key:
    • xkqzixvjvupore-rpdrrwsusa-n
  • molecular-weight:
    • 276.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality