Difference between revisions of "PWY-6019"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] ==
+== Pathway PWY-7720 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** bacteriopheophytin a
+** ophiobolin f biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** qgudpqyomulita-zasykxldsa-n
+* [NoneRXN-15427 RXN-15427]
-* molecular-weight:
+* [NoneRXN-8813 RXN-8813]
-** 888.221
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=ophiobolin f biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-17427]]
+{{#set: completion rate=0.33}}
-* [[RXN-8796]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=bacteriopheophytin a}}
-{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
-{{#set: molecular-weight=888.221}}